About 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde
2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 82530134) has the molecular formula C8H4Cl2N2O
and a molecular weight of 215.04 g/mol. Its IUPAC name is 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde |
| PubChem CID | 82530134 |
| Molecular Formula | C8H4Cl2N2O |
| Molecular Weight | 215.04 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(Cl)nc2cc(Cl)ccn12 |
| InChI | InChI=1S/C8H4Cl2N2O/c9-5-1-2-12-6(4-13)8(10)11-7(12)3-5/h1-4H |
| InChIKey | OEXDRUYMUYDKQR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde?
The IUPAC name of 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde (CID 82530134) is 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde.
What is the SMILES notation for 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde?
The canonical SMILES for 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde is O=Cc1c(Cl)nc2cc(Cl)ccn12.
What is the InChIKey of 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde?
The InChIKey is OEXDRUYMUYDKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2N2O/c9-5-1-2-12-6(4-13)8(10)11-7(12)3-5/h1-4H.
What are the key properties of 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde?
2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde has a molecular weight of 215.04 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dichloroimidazo[1,2-a]pyridine-3-carbaldehyde is sourced from PubChem (CID 82530134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).