C15H11FN4 — CID 82530319
2-[2-(4-aminophenyl)-6-fluoroimidazo[1,2-a]pyridin-3-yl]acetonitrile (PubChem CID 82530319) has the molecular formula C15H11FN4 and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-6-fluoroimidazo[1,2-a]pyridin-3-yl]acetonitrile.
| Compound Name | 2-[2-(4-aminophenyl)-6-fluoroimidazo[1,2-a]pyridin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 82530319 |
| Molecular Formula | C15H11FN4 |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-[2-(4-aminophenyl)-6-fluoroimidazo[1,2-a]pyridin-3-yl]acetonitrile |
| SMILES | N#CCc1c(-c2ccc(N)cc2)nc2ccc(F)cn12 |
| InChI | InChI=1S/C15H11FN4/c16-11-3-6-14-19-15(10-1-4-12(18)5-2-10)13(7-8-17)20(14)9-11/h1-6,9H,7,18H2 |
| InChIKey | UEWTVRRNJJSMAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|