C13H17BrN2O2 — CID 825309
2-[[(2R)-2-bromo-4-methylpentanoyl]amino]benzamide (PubChem CID 825309) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 2-[[(2R)-2-bromo-4-methylpentanoyl]amino]benzamide.
| Compound Name | 2-[[(2R)-2-bromo-4-methylpentanoyl]amino]benzamide |
|---|---|
| PubChem CID | 825309 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[[(2R)-2-bromo-4-methylpentanoyl]amino]benzamide |
| SMILES | CC(C)C[C@@H](Br)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C13H17BrN2O2/c1-8(2)7-10(14)13(18)16-11-6-4-3-5-9(11)12(15)17/h3-6,8,10H,7H2,1-2H3,(H2,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | SJSSPNMDWMSUNY-SNVBAGLBSA-N |
| XLogP | 2.53 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|