About 3-(3-methylbutylamino)propyl 2-methylpropanoate
3-(3-methylbutylamino)propyl 2-methylpropanoate (PubChem CID 82532012) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(3-methylbutylamino)propyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 3-(3-methylbutylamino)propyl 2-methylpropanoate |
| PubChem CID | 82532012 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 3-(3-methylbutylamino)propyl 2-methylpropanoate |
| SMILES | CC(C)CCNCCCOC(=O)C(C)C |
| InChI | InChI=1S/C12H25NO2/c1-10(2)6-8-13-7-5-9-15-12(14)11(3)4/h10-11,13H,5-9H2,1-4H3 |
| InChIKey | MKJMFCLUINHGAS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methylbutylamino)propyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methylbutylamino)propyl 2-methylpropanoate?
The IUPAC name of 3-(3-methylbutylamino)propyl 2-methylpropanoate (CID 82532012) is 3-(3-methylbutylamino)propyl 2-methylpropanoate.
What is the SMILES notation for 3-(3-methylbutylamino)propyl 2-methylpropanoate?
The canonical SMILES for 3-(3-methylbutylamino)propyl 2-methylpropanoate is CC(C)CCNCCCOC(=O)C(C)C.
What is the InChIKey of 3-(3-methylbutylamino)propyl 2-methylpropanoate?
The InChIKey is MKJMFCLUINHGAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-10(2)6-8-13-7-5-9-15-12(14)11(3)4/h10-11,13H,5-9H2,1-4H3.
What are the key properties of 3-(3-methylbutylamino)propyl 2-methylpropanoate?
3-(3-methylbutylamino)propyl 2-methylpropanoate has a molecular weight of 215.34 g/mol, XLogP of 2.21, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methylbutylamino)propyl 2-methylpropanoate is sourced from PubChem (CID 82532012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).