C13H14N2 — CID 82537517
N-(3,4-dimethylphenyl)pyridin-3-amine (PubChem CID 82537517) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)pyridin-3-amine.
| Compound Name | N-(3,4-dimethylphenyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82537517 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-(3,4-dimethylphenyl)pyridin-3-amine |
| SMILES | Cc1ccc(Nc2cccnc2)cc1C |
| InChI | InChI=1S/C13H14N2/c1-10-5-6-12(8-11(10)2)15-13-4-3-7-14-9-13/h3-9,15H,1-2H3 |
| InChIKey | SRDKSSCDFBMFQY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |