C14H16F3NO2 — CID 82537647
ethyl 1-(2,3,4-trifluorophenyl)piperidine-3-carboxylate (PubChem CID 82537647) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is ethyl 1-(2,3,4-trifluorophenyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(2,3,4-trifluorophenyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 82537647 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | ethyl 1-(2,3,4-trifluorophenyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H16F3NO2/c1-2-20-14(19)9-4-3-7-18(8-9)11-6-5-10(15)12(16)13(11)17/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | FVTZWDHFJCHMPN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|