C14H23N3 — CID 82538094
N,N-dimethyl-1-[4-(4-methylpiperazin-1-yl)phenyl]methanamine (PubChem CID 82538094) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N,N-dimethyl-1-[4-(4-methylpiperazin-1-yl)phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[4-(4-methylpiperazin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 82538094 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N,N-dimethyl-1-[4-(4-methylpiperazin-1-yl)phenyl]methanamine |
| SMILES | CN(C)Cc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H23N3/c1-15(2)12-13-4-6-14(7-5-13)17-10-8-16(3)9-11-17/h4-7H,8-12H2,1-3H3 |
| InChIKey | KCFSBCXRBFZRSQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|