C13H9Cl2NO — CID 82540749
1-[5-(2,3-dichlorophenyl)-3-pyridinyl]ethanone (PubChem CID 82540749) has the molecular formula C13H9Cl2NO and a molecular weight of 266.13 g/mol. Its IUPAC name is 1-[5-(2,3-dichlorophenyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[5-(2,3-dichlorophenyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 82540749 |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 1-[5-(2,3-dichlorophenyl)-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1cncc(-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C13H9Cl2NO/c1-8(17)9-5-10(7-16-6-9)11-3-2-4-12(14)13(11)15/h2-7H,1H3 |
| InChIKey | HZYCTMOILBPBLP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |