C16H15ClO3 — CID 82540809
1-[4-chloro-3-(3,4-dimethoxyphenyl)phenyl]ethanone (PubChem CID 82540809) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 1-[4-chloro-3-(3,4-dimethoxyphenyl)phenyl]ethanone.
| Compound Name | 1-[4-chloro-3-(3,4-dimethoxyphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 82540809 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-[4-chloro-3-(3,4-dimethoxyphenyl)phenyl]ethanone |
| SMILES | COc1ccc(-c2cc(C(C)=O)ccc2Cl)cc1OC |
| InChI | InChI=1S/C16H15ClO3/c1-10(18)11-4-6-14(17)13(8-11)12-5-7-15(19-2)16(9-12)20-3/h4-9H,1-3H3 |
| InChIKey | GBZQLRHYBKVVNS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |