About 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine
4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine (PubChem CID 82541472) has the molecular formula C16H17Cl2N
and a molecular weight of 294.23 g/mol. Its IUPAC name is 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine.
Molecular Properties
| Compound Name | 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine |
| PubChem CID | 82541472 |
| Molecular Formula | C16H17Cl2N |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine |
| SMILES | CC(N)CCc1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C16H17Cl2N/c1-11(19)2-3-12-4-6-13(7-5-12)14-8-9-15(17)16(18)10-14/h4-11H,2-3,19H2,1H3 |
| InChIKey | NOUKMXKBNPJNFK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine?
The IUPAC name of 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine (CID 82541472) is 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine.
What is the SMILES notation for 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine?
The canonical SMILES for 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine is CC(N)CCc1ccc(-c2ccc(Cl)c(Cl)c2)cc1.
What is the InChIKey of 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine?
The InChIKey is NOUKMXKBNPJNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2N/c1-11(19)2-3-12-4-6-13(7-5-12)14-8-9-15(17)16(18)10-14/h4-11H,2-3,19H2,1H3.
What are the key properties of 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine?
4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine has a molecular weight of 294.23 g/mol, XLogP of 4.94, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-dichlorophenyl)phenyl]butan-2-amine is sourced from PubChem (CID 82541472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).