C14H15N3 — CID 82542217
7-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 82542217) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is 7-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 7-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 82542217 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 7-pyrimidin-5-yl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | NC1CCCc2ccc(-c3cncnc3)cc21 |
| InChI | InChI=1S/C14H15N3/c15-14-3-1-2-10-4-5-11(6-13(10)14)12-7-16-9-17-8-12/h4-9,14H,1-3,15H2 |
| InChIKey | LBEVOMRJGXXNHL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |