C15H15FO3S — CID 82543076
3-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]butanoic acid (PubChem CID 82543076) has the molecular formula C15H15FO3S and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]butanoic acid.
| Compound Name | 3-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]butanoic acid |
|---|---|
| PubChem CID | 82543076 |
| Molecular Formula | C15H15FO3S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[5-(3-fluoro-4-methoxyphenyl)thiophen-2-yl]butanoic acid |
| SMILES | COc1ccc(-c2ccc(C(C)CC(=O)O)s2)cc1F |
| InChI | InChI=1S/C15H15FO3S/c1-9(7-15(17)18)13-5-6-14(20-13)10-3-4-12(19-2)11(16)8-10/h3-6,8-9H,7H2,1-2H3,(H,17,18) |
| InChIKey | YOOPIHRYSFBUMP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |