methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate

C19H19FO2 — CID 82543606

IUPACmethyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate
SMILESCOC(=O)/C=C(\C)CCc1ccc(-c2ccc(F)cc2)cc1
InChIInChI=1S/C19H19FO2/c1-14(13-19(21)22-2)3-4-15-5-7-16(8-6-15)17-9-11-18(20)12-10-17/h5-13H,3-4H2,1-2H3/b14-13+
InChIKeyCYZLKWQYRBVPSM-BUHFOSPRSA-N
MW298.36 g/mol
LogP4.54
Rot. Bonds5

About methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate

methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate (PubChem CID 82543606) has the molecular formula C19H19FO2 and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate.

Molecular Properties

Compound Namemethyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate
PubChem CID82543606
Molecular FormulaC19H19FO2
Molecular Weight298.36 g/mol
Exact Mass298.14
IUPAC Namemethyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate
SMILESCOC(=O)/C=C(\C)CCc1ccc(-c2ccc(F)cc2)cc1
InChIInChI=1S/C19H19FO2/c1-14(13-19(21)22-2)3-4-15-5-7-16(8-6-15)17-9-11-18(20)12-10-17/h5-13H,3-4H2,1-2H3/b14-13+
InChIKeyCYZLKWQYRBVPSM-BUHFOSPRSA-N
XLogP4.54
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.36
LogP ≤ 54.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate?
The IUPAC name of methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate (CID 82543606) is methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate.
What is the SMILES notation for methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate?
The canonical SMILES for methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate is COC(=O)/C=C(\C)CCc1ccc(-c2ccc(F)cc2)cc1.
What is the InChIKey of methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate?
The InChIKey is CYZLKWQYRBVPSM-BUHFOSPRSA-N. The full InChI is InChI=1S/C19H19FO2/c1-14(13-19(21)22-2)3-4-15-5-7-16(8-6-15)17-9-11-18(20)12-10-17/h5-13H,3-4H2,1-2H3/b14-13+.
What are the key properties of methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate?
methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate has a molecular weight of 298.36 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5-[4-(4-fluorophenyl)phenyl]-3-methylpent-2-enoate is sourced from PubChem (CID 82543606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).