C14H14N2O2S — CID 82543741
methyl (E)-3-(2-methyl-4-pyridin-3-yl-1,3-thiazol-5-yl)but-2-enoate (PubChem CID 82543741) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is methyl (E)-3-(2-methyl-4-pyridin-3-yl-1,3-thiazol-5-yl)but-2-enoate.
| Compound Name | methyl (E)-3-(2-methyl-4-pyridin-3-yl-1,3-thiazol-5-yl)but-2-enoate |
|---|---|
| PubChem CID | 82543741 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | methyl (E)-3-(2-methyl-4-pyridin-3-yl-1,3-thiazol-5-yl)but-2-enoate |
| SMILES | COC(=O)/C=C(\C)c1sc(C)nc1-c1cccnc1 |
| InChI | InChI=1S/C14H14N2O2S/c1-9(7-12(17)18-3)14-13(16-10(2)19-14)11-5-4-6-15-8-11/h4-8H,1-3H3/b9-7+ |
| InChIKey | UPBAKXBKPWFYAE-VQHVLOKHSA-N |
| XLogP | 3.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|