C19H20O2 — CID 82544146
(E)-3-methyl-5-[3-(4-methylphenyl)phenyl]pent-2-enoic acid (PubChem CID 82544146) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (E)-3-methyl-5-[3-(4-methylphenyl)phenyl]pent-2-enoic acid.
| Compound Name | (E)-3-methyl-5-[3-(4-methylphenyl)phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 82544146 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (E)-3-methyl-5-[3-(4-methylphenyl)phenyl]pent-2-enoic acid |
| SMILES | C/C(=C\C(=O)O)CCc1cccc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H20O2/c1-14-7-10-17(11-8-14)18-5-3-4-16(13-18)9-6-15(2)12-19(20)21/h3-5,7-8,10-13H,6,9H2,1-2H3,(H,20,21)/b15-12+ |
| InChIKey | KAWZGAPYZPXEBK-NTCAYCPXSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|