C14H20F3N3 — CID 82544696
3-[1-(aminomethyl)-4,5,6-trifluoro-1,3-dihydroisoindol-2-yl]-N,N-dimethylpropan-1-amine (PubChem CID 82544696) has the molecular formula C14H20F3N3 and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-[1-(aminomethyl)-4,5,6-trifluoro-1,3-dihydroisoindol-2-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[1-(aminomethyl)-4,5,6-trifluoro-1,3-dihydroisoindol-2-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 82544696 |
| Molecular Formula | C14H20F3N3 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-[1-(aminomethyl)-4,5,6-trifluoro-1,3-dihydroisoindol-2-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCN1Cc2c(cc(F)c(F)c2F)C1CN |
| InChI | InChI=1S/C14H20F3N3/c1-19(2)4-3-5-20-8-10-9(12(20)7-18)6-11(15)14(17)13(10)16/h6,12H,3-5,7-8,18H2,1-2H3 |
| InChIKey | XQMMDYRKMAWPEQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|