C12H13F3N2 — CID 82544719
(2-cyclopropyl-4,5,6-trifluoro-1,3-dihydroisoindol-1-yl)methanamine (PubChem CID 82544719) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is (2-cyclopropyl-4,5,6-trifluoro-1,3-dihydroisoindol-1-yl)methanamine.
| Compound Name | (2-cyclopropyl-4,5,6-trifluoro-1,3-dihydroisoindol-1-yl)methanamine |
|---|---|
| PubChem CID | 82544719 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (2-cyclopropyl-4,5,6-trifluoro-1,3-dihydroisoindol-1-yl)methanamine |
| SMILES | NCC1c2cc(F)c(F)c(F)c2CN1C1CC1 |
| InChI | InChI=1S/C12H13F3N2/c13-9-3-7-8(11(14)12(9)15)5-17(6-1-2-6)10(7)4-16/h3,6,10H,1-2,4-5,16H2 |
| InChIKey | CLKQUNYWZPJMLI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|