About (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine
(2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine (PubChem CID 82544746) has the molecular formula C19H24N2
and a molecular weight of 280.41 g/mol. Its IUPAC name is (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine.
Molecular Properties
| Compound Name | (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine |
| PubChem CID | 82544746 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine |
| SMILES | NCC1c2ccc3ccccc3c2CN1C1CCCCC1 |
| InChI | InChI=1S/C19H24N2/c20-12-19-17-11-10-14-6-4-5-9-16(14)18(17)13-21(19)15-7-2-1-3-8-15/h4-6,9-11,15,19H,1-3,7-8,12-13,20H2 |
| InChIKey | LLQAQFWKXCTRAS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine?
The IUPAC name of (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine (CID 82544746) is (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine.
What is the SMILES notation for (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine?
The canonical SMILES for (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine is NCC1c2ccc3ccccc3c2CN1C1CCCCC1.
What is the InChIKey of (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine?
The InChIKey is LLQAQFWKXCTRAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2/c20-12-19-17-11-10-14-6-4-5-9-16(14)18(17)13-21(19)15-7-2-1-3-8-15/h4-6,9-11,15,19H,1-3,7-8,12-13,20H2.
What are the key properties of (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine?
(2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine has a molecular weight of 280.41 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexyl-1,3-dihydrobenzo[e]isoindol-3-yl)methanamine is sourced from PubChem (CID 82544746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).