About 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol
4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol (PubChem CID 82545041) has the molecular formula C15H20F2N2O
and a molecular weight of 282.33 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol |
| PubChem CID | 82545041 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol |
| SMILES | NCC1c2cc(F)cc(F)c2CN1C1CCC(O)CC1 |
| InChI | InChI=1S/C15H20F2N2O/c16-9-5-12-13(14(17)6-9)8-19(15(12)7-18)10-1-3-11(20)4-2-10/h5-6,10-11,15,20H,1-4,7-8,18H2 |
| InChIKey | OWIBQBFQSDNJNA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol?
The IUPAC name of 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol (CID 82545041) is 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol.
What is the SMILES notation for 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol?
The canonical SMILES for 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol is NCC1c2cc(F)cc(F)c2CN1C1CCC(O)CC1.
What is the InChIKey of 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol?
The InChIKey is OWIBQBFQSDNJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O/c16-9-5-12-13(14(17)6-9)8-19(15(12)7-18)10-1-3-11(20)4-2-10/h5-6,10-11,15,20H,1-4,7-8,18H2.
What are the key properties of 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol?
4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol has a molecular weight of 282.33 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(aminomethyl)-4,6-difluoro-1,3-dihydroisoindol-2-yl]cyclohexan-1-ol is sourced from PubChem (CID 82545041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).