About (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine
(2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine (PubChem CID 82545132) has the molecular formula C14H18F2N2
and a molecular weight of 252.31 g/mol. Its IUPAC name is (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine.
Molecular Properties
| Compound Name | (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine |
| PubChem CID | 82545132 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine |
| SMILES | NCC1c2c(F)cc(F)cc2CN1C1CCCC1 |
| InChI | InChI=1S/C14H18F2N2/c15-10-5-9-8-18(11-3-1-2-4-11)13(7-17)14(9)12(16)6-10/h5-6,11,13H,1-4,7-8,17H2 |
| InChIKey | IYEMNJRINXVPNH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine?
The IUPAC name of (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine (CID 82545132) is (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine.
What is the SMILES notation for (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine?
The canonical SMILES for (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine is NCC1c2c(F)cc(F)cc2CN1C1CCCC1.
What is the InChIKey of (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine?
The InChIKey is IYEMNJRINXVPNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N2/c15-10-5-9-8-18(11-3-1-2-4-11)13(7-17)14(9)12(16)6-10/h5-6,11,13H,1-4,7-8,17H2.
What are the key properties of (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine?
(2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine has a molecular weight of 252.31 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopentyl-5,7-difluoro-1,3-dihydroisoindol-1-yl)methanamine is sourced from PubChem (CID 82545132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).