About [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine
[2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine (PubChem CID 82545249) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine.
Molecular Properties
| Compound Name | [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine |
| PubChem CID | 82545249 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine |
| SMILES | NCC1c2ccccc2CN1CCc1ccccc1 |
| InChI | InChI=1S/C17H20N2/c18-12-17-16-9-5-4-8-15(16)13-19(17)11-10-14-6-2-1-3-7-14/h1-9,17H,10-13,18H2 |
| InChIKey | FOVAQODVYPSZBN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine?
The IUPAC name of [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine (CID 82545249) is [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine.
What is the SMILES notation for [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine?
The canonical SMILES for [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine is NCC1c2ccccc2CN1CCc1ccccc1.
What is the InChIKey of [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine?
The InChIKey is FOVAQODVYPSZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c18-12-17-16-9-5-4-8-15(16)13-19(17)11-10-14-6-2-1-3-7-14/h1-9,17H,10-13,18H2.
What are the key properties of [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine?
[2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine has a molecular weight of 252.36 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-phenylethyl)-1,3-dihydroisoindol-1-yl]methanamine is sourced from PubChem (CID 82545249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).