C16H26N2O — CID 82545401
(2-hexyl-4-methoxy-1,3-dihydroisoindol-1-yl)methanamine (PubChem CID 82545401) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is (2-hexyl-4-methoxy-1,3-dihydroisoindol-1-yl)methanamine.
| Compound Name | (2-hexyl-4-methoxy-1,3-dihydroisoindol-1-yl)methanamine |
|---|---|
| PubChem CID | 82545401 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (2-hexyl-4-methoxy-1,3-dihydroisoindol-1-yl)methanamine |
| SMILES | CCCCCCN1Cc2c(OC)cccc2C1CN |
| InChI | InChI=1S/C16H26N2O/c1-3-4-5-6-10-18-12-14-13(15(18)11-17)8-7-9-16(14)19-2/h7-9,15H,3-6,10-12,17H2,1-2H3 |
| InChIKey | PFEFCLOFGGRIIR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|