C12H11FN4O3 — CID 82546156
2-[(5-amino-1-methylpyrazole-4-carbonyl)amino]-5-fluorobenzoic acid (PubChem CID 82546156) has the molecular formula C12H11FN4O3 and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-[(5-amino-1-methylpyrazole-4-carbonyl)amino]-5-fluorobenzoic acid.
| Compound Name | 2-[(5-amino-1-methylpyrazole-4-carbonyl)amino]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 82546156 |
| Molecular Formula | C12H11FN4O3 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[(5-amino-1-methylpyrazole-4-carbonyl)amino]-5-fluorobenzoic acid |
| SMILES | Cn1ncc(C(=O)Nc2ccc(F)cc2C(=O)O)c1N |
| InChI | InChI=1S/C12H11FN4O3/c1-17-10(14)8(5-15-17)11(18)16-9-3-2-6(13)4-7(9)12(19)20/h2-5H,14H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | KINWRJXEUSJYEC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |