C13H14N4O2S — CID 82547522
4-[[2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetyl]amino]benzamide (PubChem CID 82547522) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 4-[[2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 82547522 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-[[2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetyl]amino]benzamide |
| SMILES | NCc1nc(CC(=O)Nc2ccc(C(N)=O)cc2)cs1 |
| InChI | InChI=1S/C13H14N4O2S/c14-6-12-17-10(7-20-12)5-11(18)16-9-3-1-8(2-4-9)13(15)19/h1-4,7H,5-6,14H2,(H2,15,19)(H,16,18) |
| InChIKey | JRCWTYJRHLJOTP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |