C7H11N3OS — CID 82547702
2-[2-(1-aminoethyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 82547702) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-[2-(1-aminoethyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | 2-[2-(1-aminoethyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 82547702 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-[2-(1-aminoethyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CC(N)c1nc(CC(N)=O)cs1 |
| InChI | InChI=1S/C7H11N3OS/c1-4(8)7-10-5(3-12-7)2-6(9)11/h3-4H,2,8H2,1H3,(H2,9,11) |
| InChIKey | UGBJLURRPQNLMP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |