C12H12N4O2S — CID 82548064
2-[2-(4-aminophenyl)-1,3-thiazol-4-yl]-N-carbamoylacetamide (PubChem CID 82548064) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-[2-(4-aminophenyl)-1,3-thiazol-4-yl]-N-carbamoylacetamide.
| Compound Name | 2-[2-(4-aminophenyl)-1,3-thiazol-4-yl]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 82548064 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[2-(4-aminophenyl)-1,3-thiazol-4-yl]-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)Cc1csc(-c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C12H12N4O2S/c13-8-3-1-7(2-4-8)11-15-9(6-19-11)5-10(17)16-12(14)18/h1-4,6H,5,13H2,(H3,14,16,17,18) |
| InChIKey | USIVGFYAJNMHMP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|