About 2-methylprop-1-ene
2-methylprop-1-ene (PubChem CID 8255) has the molecular formula C4H8
and a molecular weight of 56.11 g/mol. Its IUPAC name is 2-methylprop-1-ene.
Molecular Properties
| Compound Name | 2-methylprop-1-ene |
| PubChem CID | 8255 |
| Molecular Formula | C4H8 |
| Molecular Weight | 56.11 g/mol |
| Exact Mass | 56.06 |
| IUPAC Name | 2-methylprop-1-ene |
| SMILES | C=C(C)C |
| InChI | InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 |
| InChIKey | VQTUBCCKSQIDNK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 56.11 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-1-ene?
The IUPAC name of 2-methylprop-1-ene (CID 8255) is 2-methylprop-1-ene.
What is the SMILES notation for 2-methylprop-1-ene?
The canonical SMILES for 2-methylprop-1-ene is C=C(C)C.
What is the InChIKey of 2-methylprop-1-ene?
The InChIKey is VQTUBCCKSQIDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3.
What are the key properties of 2-methylprop-1-ene?
2-methylprop-1-ene has a molecular weight of 56.11 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-1-ene is sourced from PubChem (CID 8255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).