About 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one
2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 825500) has the molecular formula C20H21N3O2
and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| PubChem CID | 825500 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | COc1ccccc1/N=C/c1c(C)[nH]n(-c2ccc(C)cc2C)c1=O |
| InChI | InChI=1S/C20H21N3O2/c1-13-9-10-18(14(2)11-13)23-20(24)16(15(3)22-23)12-21-17-7-5-6-8-19(17)25-4/h5-12,22H,1-4H3/b21-12+ |
| InChIKey | FITIMWGUVPKSEJ-CIAFOILYSA-N |
| XLogP | 3.85 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one?
The IUPAC name of 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (CID 825500) is 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
What is the SMILES notation for 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one?
The canonical SMILES for 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one is COc1ccccc1/N=C/c1c(C)[nH]n(-c2ccc(C)cc2C)c1=O.
What is the InChIKey of 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one?
The InChIKey is FITIMWGUVPKSEJ-CIAFOILYSA-N. The full InChI is InChI=1S/C20H21N3O2/c1-13-9-10-18(14(2)11-13)23-20(24)16(15(3)22-23)12-21-17-7-5-6-8-19(17)25-4/h5-12,22H,1-4H3/b21-12+.
What are the key properties of 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one?
2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one has a molecular weight of 335.41 g/mol, XLogP of 3.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)-4-[(2-methoxyphenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 825500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).