C13H18O4S — CID 82550632
methyl 3-(4-propylsulfonylphenyl)propanoate (PubChem CID 82550632) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is methyl 3-(4-propylsulfonylphenyl)propanoate.
| Compound Name | methyl 3-(4-propylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 82550632 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl 3-(4-propylsulfonylphenyl)propanoate |
| SMILES | CCCS(=O)(=O)c1ccc(CCC(=O)OC)cc1 |
| InChI | InChI=1S/C13H18O4S/c1-3-10-18(15,16)12-7-4-11(5-8-12)6-9-13(14)17-2/h4-5,7-8H,3,6,9-10H2,1-2H3 |
| InChIKey | KKJDECUWNWHJTO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |