About 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol
4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol (PubChem CID 82553071) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol.
Molecular Properties
| Compound Name | 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol |
| PubChem CID | 82553071 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1c(O)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C11H16ClNO/c1-7-6-10(14)9(4-5-13-3)8(2)11(7)12/h6,13-14H,4-5H2,1-3H3 |
| InChIKey | KUTHITFPPOFQSK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol?
The IUPAC name of 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol (CID 82553071) is 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol.
What is the SMILES notation for 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol?
The canonical SMILES for 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol is CNCCc1c(O)cc(C)c(Cl)c1C.
What is the InChIKey of 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol?
The InChIKey is KUTHITFPPOFQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16ClNO/c1-7-6-10(14)9(4-5-13-3)8(2)11(7)12/h6,13-14H,4-5H2,1-3H3.
What are the key properties of 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol?
4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol has a molecular weight of 213.71 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3,5-dimethyl-2-[2-(methylamino)ethyl]phenol is sourced from PubChem (CID 82553071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).