C12H14N4O3 — CID 82554365
6-[(2-aminophenyl)methyl]-2-(2-hydroxyethyl)-1,2,4-triazine-3,5-dione (PubChem CID 82554365) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 6-[(2-aminophenyl)methyl]-2-(2-hydroxyethyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(2-aminophenyl)methyl]-2-(2-hydroxyethyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 82554365 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 6-[(2-aminophenyl)methyl]-2-(2-hydroxyethyl)-1,2,4-triazine-3,5-dione |
| SMILES | Nc1ccccc1Cc1nn(CCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N4O3/c13-9-4-2-1-3-8(9)7-10-11(18)14-12(19)16(15-10)5-6-17/h1-4,17H,5-7,13H2,(H,14,18,19) |
| InChIKey | QDXGSZOKAOFBCO-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|