C17H14N4O4 — CID 82554449
4-[[6-(2-aminophenyl)-3,5-dioxo-1,2,4-triazin-2-yl]methyl]benzoic acid (PubChem CID 82554449) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-[[6-(2-aminophenyl)-3,5-dioxo-1,2,4-triazin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[6-(2-aminophenyl)-3,5-dioxo-1,2,4-triazin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 82554449 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[[6-(2-aminophenyl)-3,5-dioxo-1,2,4-triazin-2-yl]methyl]benzoic acid |
| SMILES | Nc1ccccc1-c1nn(Cc2ccc(C(=O)O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H14N4O4/c18-13-4-2-1-3-12(13)14-15(22)19-17(25)21(20-14)9-10-5-7-11(8-6-10)16(23)24/h1-8H,9,18H2,(H,23,24)(H,19,22,25) |
| InChIKey | VVERPTFXSOUSJW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|