C13H14N6OS — CID 82554988
6-[(2-amino-4-methylphenyl)methyl]-8-methyl-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 82554988) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 6-[(2-amino-4-methylphenyl)methyl]-8-methyl-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 6-[(2-amino-4-methylphenyl)methyl]-8-methyl-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 82554988 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-[(2-amino-4-methylphenyl)methyl]-8-methyl-3-sulfanylidene-2H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | Cc1ccc(Cc2nn3c(=S)[nH]nc3n(C)c2=O)c(N)c1 |
| InChI | InChI=1S/C13H14N6OS/c1-7-3-4-8(9(14)5-7)6-10-11(20)18(2)12-15-16-13(21)19(12)17-10/h3-5H,6,14H2,1-2H3,(H,16,21) |
| InChIKey | CWOHQJKWUMKZNE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 94.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|