C13H12N6O3 — CID 82555054
2-[6-[(2-aminophenyl)methyl]-7-oxo-[1,2,4]triazolo[4,3-b][1,2,4]triazin-8-yl]acetic acid (PubChem CID 82555054) has the molecular formula C13H12N6O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[6-[(2-aminophenyl)methyl]-7-oxo-[1,2,4]triazolo[4,3-b][1,2,4]triazin-8-yl]acetic acid.
| Compound Name | 2-[6-[(2-aminophenyl)methyl]-7-oxo-[1,2,4]triazolo[4,3-b][1,2,4]triazin-8-yl]acetic acid |
|---|---|
| PubChem CID | 82555054 |
| Molecular Formula | C13H12N6O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-[6-[(2-aminophenyl)methyl]-7-oxo-[1,2,4]triazolo[4,3-b][1,2,4]triazin-8-yl]acetic acid |
| SMILES | Nc1ccccc1Cc1nn2cnnc2n(CC(=O)O)c1=O |
| InChI | InChI=1S/C13H12N6O3/c14-9-4-2-1-3-8(9)5-10-12(22)18(6-11(20)21)13-16-15-7-19(13)17-10/h1-4,7H,5-6,14H2,(H,20,21) |
| InChIKey | JAGKELCJQUDQRI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|