C13H13N5 — CID 82555742
7-N-benzyl-[1,2,4]triazolo[1,5-a]pyridine-2,7-diamine (PubChem CID 82555742) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 7-N-benzyl-[1,2,4]triazolo[1,5-a]pyridine-2,7-diamine.
| Compound Name | 7-N-benzyl-[1,2,4]triazolo[1,5-a]pyridine-2,7-diamine |
|---|---|
| PubChem CID | 82555742 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 7-N-benzyl-[1,2,4]triazolo[1,5-a]pyridine-2,7-diamine |
| SMILES | Nc1nc2cc(NCc3ccccc3)ccn2n1 |
| InChI | InChI=1S/C13H13N5/c14-13-16-12-8-11(6-7-18(12)17-13)15-9-10-4-2-1-3-5-10/h1-8,15H,9H2,(H2,14,17) |
| InChIKey | WWARWKZHIQNOKB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |