C12H13FN4O — CID 82557011
4-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-fluorophenol (PubChem CID 82557011) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-fluorophenol.
| Compound Name | 4-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-fluorophenol |
|---|---|
| PubChem CID | 82557011 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-fluorophenol |
| SMILES | Nc1nc2n(n1)CCCC2c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C12H13FN4O/c13-9-6-7(3-4-10(9)18)8-2-1-5-17-11(8)15-12(14)16-17/h3-4,6,8,18H,1-2,5H2,(H2,14,16) |
| InChIKey | RKNDKOOXVVTGHJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |