C13H13F3N4 — CID 82557023
8-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 82557023) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 8-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 82557023 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 8-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Nc1nc2n(n1)CCCC2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)9-5-3-8(4-6-9)10-2-1-7-20-11(10)18-12(17)19-20/h3-6,10H,1-2,7H2,(H2,17,19) |
| InChIKey | CEGNBHGWWAXIKP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |