C14H16N4O2 — CID 82557239
methyl 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate (PubChem CID 82557239) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is methyl 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate.
| Compound Name | methyl 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 82557239 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl 3-(2-amino-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)benzoate |
| SMILES | COC(=O)c1cccc(C2CCCc3nc(N)nn32)c1 |
| InChI | InChI=1S/C14H16N4O2/c1-20-13(19)10-5-2-4-9(8-10)11-6-3-7-12-16-14(15)17-18(11)12/h2,4-5,8,11H,3,6-7H2,1H3,(H2,15,17) |
| InChIKey | PFQMERXLYVHXGG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |