C13H16N4O2 — CID 82557730
2-(2-amino-8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)phenol (PubChem CID 82557730) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-(2-amino-8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)phenol.
| Compound Name | 2-(2-amino-8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)phenol |
|---|---|
| PubChem CID | 82557730 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-(2-amino-8-methoxy-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-5-yl)phenol |
| SMILES | COC1CCC(c2ccccc2O)n2nc(N)nc21 |
| InChI | InChI=1S/C13H16N4O2/c1-19-11-7-6-9(8-4-2-3-5-10(8)18)17-12(11)15-13(14)16-17/h2-5,9,11,18H,6-7H2,1H3,(H2,14,16) |
| InChIKey | DLAIRWNHFWPWSS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|