C14H18BrN3 — CID 82558169
4-[2-[(3-bromophenyl)methyl]imidazol-1-yl]butan-1-amine (PubChem CID 82558169) has the molecular formula C14H18BrN3 and a molecular weight of 308.22 g/mol. Its IUPAC name is 4-[2-[(3-bromophenyl)methyl]imidazol-1-yl]butan-1-amine.
| Compound Name | 4-[2-[(3-bromophenyl)methyl]imidazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 82558169 |
| Molecular Formula | C14H18BrN3 |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[2-[(3-bromophenyl)methyl]imidazol-1-yl]butan-1-amine |
| SMILES | NCCCCn1ccnc1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrN3/c15-13-5-3-4-12(10-13)11-14-17-7-9-18(14)8-2-1-6-16/h3-5,7,9-10H,1-2,6,8,11,16H2 |
| InChIKey | XYGLPSKTYMLQFI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|