C15H21N3O — CID 82558328
N-methyl-3-[2-(2-phenoxyethyl)imidazol-1-yl]propan-1-amine (PubChem CID 82558328) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is N-methyl-3-[2-(2-phenoxyethyl)imidazol-1-yl]propan-1-amine.
| Compound Name | N-methyl-3-[2-(2-phenoxyethyl)imidazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 82558328 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-methyl-3-[2-(2-phenoxyethyl)imidazol-1-yl]propan-1-amine |
| SMILES | CNCCCn1ccnc1CCOc1ccccc1 |
| InChI | InChI=1S/C15H21N3O/c1-16-9-5-11-18-12-10-17-15(18)8-13-19-14-6-3-2-4-7-14/h2-4,6-7,10,12,16H,5,8-9,11,13H2,1H3 |
| InChIKey | UEBWIZNIZSEYFW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|