About 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine
4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine (PubChem CID 82558361) has the molecular formula C15H17F2N3
and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine.
Molecular Properties
| Compound Name | 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine |
| PubChem CID | 82558361 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine |
| SMILES | Fc1ccc(Cc2nccn2C2CCNCC2)c(F)c1 |
| InChI | InChI=1S/C15H17F2N3/c16-12-2-1-11(14(17)10-12)9-15-19-7-8-20(15)13-3-5-18-6-4-13/h1-2,7-8,10,13,18H,3-6,9H2 |
| InChIKey | QXHGBVZWZFTBPF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine?
The IUPAC name of 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine (CID 82558361) is 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine.
What is the SMILES notation for 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine?
The canonical SMILES for 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine is Fc1ccc(Cc2nccn2C2CCNCC2)c(F)c1.
What is the InChIKey of 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine?
The InChIKey is QXHGBVZWZFTBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3/c16-12-2-1-11(14(17)10-12)9-15-19-7-8-20(15)13-3-5-18-6-4-13/h1-2,7-8,10,13,18H,3-6,9H2.
What are the key properties of 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine?
4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine has a molecular weight of 277.32 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(2,4-difluorophenyl)methyl]imidazol-1-yl]piperidine is sourced from PubChem (CID 82558361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).