C17H14F3N3 — CID 82558402
3-[[2-[(2,3,4-trifluorophenyl)methyl]imidazol-1-yl]methyl]aniline (PubChem CID 82558402) has the molecular formula C17H14F3N3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 3-[[2-[(2,3,4-trifluorophenyl)methyl]imidazol-1-yl]methyl]aniline.
| Compound Name | 3-[[2-[(2,3,4-trifluorophenyl)methyl]imidazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 82558402 |
| Molecular Formula | C17H14F3N3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 3-[[2-[(2,3,4-trifluorophenyl)methyl]imidazol-1-yl]methyl]aniline |
| SMILES | Nc1cccc(Cn2ccnc2Cc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H14F3N3/c18-14-5-4-12(16(19)17(14)20)9-15-22-6-7-23(15)10-11-2-1-3-13(21)8-11/h1-8H,9-10,21H2 |
| InChIKey | XWXLILWVGHGADK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|