C18H18N4S — CID 82558661
2-[[2-[(4-aminophenyl)methyl]imidazol-1-yl]methyl]benzenecarbothioamide (PubChem CID 82558661) has the molecular formula C18H18N4S and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-[[2-[(4-aminophenyl)methyl]imidazol-1-yl]methyl]benzenecarbothioamide.
| Compound Name | 2-[[2-[(4-aminophenyl)methyl]imidazol-1-yl]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 82558661 |
| Molecular Formula | C18H18N4S |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[[2-[(4-aminophenyl)methyl]imidazol-1-yl]methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1Cn1ccnc1Cc1ccc(N)cc1 |
| InChI | InChI=1S/C18H18N4S/c19-15-7-5-13(6-8-15)11-17-21-9-10-22(17)12-14-3-1-2-4-16(14)18(20)23/h1-10H,11-12,19H2,(H2,20,23) |
| InChIKey | KPRNACOOKMXHKQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|