C13H15Cl2N3 — CID 82559619
3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-N-methylpropan-1-amine (PubChem CID 82559619) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 82559619 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)imidazol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCn1ccnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3/c1-16-5-2-7-18-8-6-17-13(18)10-3-4-11(14)12(15)9-10/h3-4,6,8-9,16H,2,5,7H2,1H3 |
| InChIKey | HELULKFJRHJFGY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|