C14H18N2O2 — CID 82560023
2-[2-[2-(4-methoxyphenyl)ethyl]imidazol-1-yl]ethanol (PubChem CID 82560023) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[2-[2-(4-methoxyphenyl)ethyl]imidazol-1-yl]ethanol.
| Compound Name | 2-[2-[2-(4-methoxyphenyl)ethyl]imidazol-1-yl]ethanol |
|---|---|
| PubChem CID | 82560023 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-[2-[2-(4-methoxyphenyl)ethyl]imidazol-1-yl]ethanol |
| SMILES | COc1ccc(CCc2nccn2CCO)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-18-13-5-2-12(3-6-13)4-7-14-15-8-9-16(14)10-11-17/h2-3,5-6,8-9,17H,4,7,10-11H2,1H3 |
| InChIKey | OEYRIULODJTQIE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |