methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate

C18H14F2N2O2 — CID 82561233

IUPACmethyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2ccnc2-c2ccc(F)c(F)c2)c1
InChIInChI=1S/C18H14F2N2O2/c1-24-18(23)14-4-2-3-12(9-14)11-22-8-7-21-17(22)13-5-6-15(19)16(20)10-13/h2-10H,11H2,1H3
InChIKeySVXHHVOGDDGGAK-UHFFFAOYSA-N
MW328.32 g/mol
LogP3.66
Rot. Bonds4

About methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate

methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate (PubChem CID 82561233) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate
PubChem CID82561233
Molecular FormulaC18H14F2N2O2
Molecular Weight328.32 g/mol
Exact Mass328.10
IUPAC Namemethyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate
SMILESCOC(=O)c1cccc(Cn2ccnc2-c2ccc(F)c(F)c2)c1
InChIInChI=1S/C18H14F2N2O2/c1-24-18(23)14-4-2-3-12(9-14)11-22-8-7-21-17(22)13-5-6-15(19)16(20)10-13/h2-10H,11H2,1H3
InChIKeySVXHHVOGDDGGAK-UHFFFAOYSA-N
XLogP3.66
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500328.32
LogP ≤ 53.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate?
The IUPAC name of methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate (CID 82561233) is methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate.
What is the SMILES notation for methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate?
The canonical SMILES for methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate is COC(=O)c1cccc(Cn2ccnc2-c2ccc(F)c(F)c2)c1.
What is the InChIKey of methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate?
The InChIKey is SVXHHVOGDDGGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N2O2/c1-24-18(23)14-4-2-3-12(9-14)11-22-8-7-21-17(22)13-5-6-15(19)16(20)10-13/h2-10H,11H2,1H3.
What are the key properties of methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate?
methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate has a molecular weight of 328.32 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-(3,4-difluorophenyl)imidazol-1-yl]methyl]benzoate is sourced from PubChem (CID 82561233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).