C19H14F3N3 — CID 82561544
4-[[2-[[2-(trifluoromethyl)phenyl]methyl]imidazol-1-yl]methyl]benzonitrile (PubChem CID 82561544) has the molecular formula C19H14F3N3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 4-[[2-[[2-(trifluoromethyl)phenyl]methyl]imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-[[2-(trifluoromethyl)phenyl]methyl]imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 82561544 |
| Molecular Formula | C19H14F3N3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 4-[[2-[[2-(trifluoromethyl)phenyl]methyl]imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2ccnc2Cc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F3N3/c20-19(21,22)17-4-2-1-3-16(17)11-18-24-9-10-25(18)13-15-7-5-14(12-23)6-8-15/h1-10H,11,13H2 |
| InChIKey | XEKOCKUPPOZJLX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |