C17H11Cl2N3 — CID 82561753
4-[[2-(2,3-dichlorophenyl)imidazol-1-yl]methyl]benzonitrile (PubChem CID 82561753) has the molecular formula C17H11Cl2N3 and a molecular weight of 328.20 g/mol. Its IUPAC name is 4-[[2-(2,3-dichlorophenyl)imidazol-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[2-(2,3-dichlorophenyl)imidazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 82561753 |
| Molecular Formula | C17H11Cl2N3 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 4-[[2-(2,3-dichlorophenyl)imidazol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2ccnc2-c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H11Cl2N3/c18-15-3-1-2-14(16(15)19)17-21-8-9-22(17)11-13-6-4-12(10-20)5-7-13/h1-9H,11H2 |
| InChIKey | KRJGINQCZNZRLD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |