C10H6ClN5OS — CID 82562504
8-chloro-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carbothioamide (PubChem CID 82562504) has the molecular formula C10H6ClN5OS and a molecular weight of 279.71 g/mol. Its IUPAC name is 8-chloro-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carbothioamide.
| Compound Name | 8-chloro-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carbothioamide |
|---|---|
| PubChem CID | 82562504 |
| Molecular Formula | C10H6ClN5OS |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 8-chloro-2-oxo-1H-[1,2,4]triazino[2,3-a]benzimidazole-3-carbothioamide |
| SMILES | NC(=S)c1nc2nc3ccc(Cl)cc3n2[nH]c1=O |
| InChI | InChI=1S/C10H6ClN5OS/c11-4-1-2-5-6(3-4)16-10(13-5)14-7(8(12)18)9(17)15-16/h1-3H,(H2,12,18)(H,15,17) |
| InChIKey | KDVAQWNCVYKLSJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|